C10H8Cl2N2O2 — CID 134038171
5-[(2,3-dichlorophenoxy)methyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 134038171) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenoxy)methyl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[(2,3-dichlorophenoxy)methyl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 134038171 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 5-[(2,3-dichlorophenoxy)methyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(COc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N2O2/c1-6-13-9(16-14-6)5-15-8-4-2-3-7(11)10(8)12/h2-4H,5H2,1H3 |
| InChIKey | GOLPHUQRNQRJDR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |