C15H10Cl2N2O2 — CID 7611454
5-[(2,3-dichlorophenoxy)methyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 7611454) has the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenoxy)methyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[(2,3-dichlorophenoxy)methyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 7611454 |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 5-[(2,3-dichlorophenoxy)methyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | Clc1cccc(OCc2nc(-c3ccccc3)no2)c1Cl |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-11-7-4-8-12(14(11)17)20-9-13-18-15(19-21-13)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | XNWQLEDGFPKVHM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |