C14H16N2O5 — CID 43366553
3-ethoxy-2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid (PubChem CID 43366553) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-ethoxy-2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid.
| Compound Name | 3-ethoxy-2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 43366553 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-ethoxy-2-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid |
| SMILES | CCOc1cccc(C(=O)O)c1OCc1nc(CC)no1 |
| InChI | InChI=1S/C14H16N2O5/c1-3-11-15-12(21-16-11)8-20-13-9(14(17)18)6-5-7-10(13)19-4-2/h5-7H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | MGEAGDUBRKIHKS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |