C12H10INO3S — CID 82995712
5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzoic acid (PubChem CID 82995712) has the molecular formula C12H10INO3S and a molecular weight of 375.19 g/mol. Its IUPAC name is 5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzoic acid.
| Compound Name | 5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 82995712 |
| Molecular Formula | C12H10INO3S |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)methoxy]benzoic acid |
| SMILES | Cc1ncc(COc2ccc(I)cc2C(=O)O)s1 |
| InChI | InChI=1S/C12H10INO3S/c1-7-14-5-9(18-7)6-17-11-3-2-8(13)4-10(11)12(15)16/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | GGHCXCJGKQQYFZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|