C14H14ClIN2O3 — CID 82991140
2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]-5-iodobenzoic acid (PubChem CID 82991140) has the molecular formula C14H14ClIN2O3 and a molecular weight of 420.63 g/mol. Its IUPAC name is 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]-5-iodobenzoic acid.
| Compound Name | 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 82991140 |
| Molecular Formula | C14H14ClIN2O3 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]-5-iodobenzoic acid |
| SMILES | CCn1nc(C)c(Cl)c1COc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C14H14ClIN2O3/c1-3-18-11(13(15)8(2)17-18)7-21-12-5-4-9(16)6-10(12)14(19)20/h4-6H,3,7H2,1-2H3,(H,19,20) |
| InChIKey | LHQRSFFGKXYMTG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|