C12H13ClN2O3S — CID 66438891
4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]thiophene-2-carboxylic acid (PubChem CID 66438891) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is 4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66438891 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]thiophene-2-carboxylic acid |
| SMILES | CCn1nc(C)c(Cl)c1COc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C12H13ClN2O3S/c1-3-15-9(11(13)7(2)14-15)5-18-8-4-10(12(16)17)19-6-8/h4,6H,3,5H2,1-2H3,(H,16,17) |
| InChIKey | WSGHYOTXCCYVES-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |