C14H21ClN2O3 — CID 114451002
4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]cyclohexane-1-carboxylic acid (PubChem CID 114451002) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114451002 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methoxy]cyclohexane-1-carboxylic acid |
| SMILES | CCn1nc(C)c(Cl)c1COC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C14H21ClN2O3/c1-3-17-12(13(15)9(2)16-17)8-20-11-6-4-10(5-7-11)14(18)19/h10-11H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | QVBHKUANHDWKLT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |