C13H21ClN2O3 — CID 79496140
3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-one (PubChem CID 79496140) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-one.
| Compound Name | 3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-one |
|---|---|
| PubChem CID | 79496140 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-one |
| SMILES | CCOC(OCC)C(=O)Cc1c(Cl)c(C)nn1CC |
| InChI | InChI=1S/C13H21ClN2O3/c1-5-16-10(12(14)9(4)15-16)8-11(17)13(18-6-2)19-7-3/h13H,5-8H2,1-4H3 |
| InChIKey | YADPRIYTPRRNKI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|