C12H16ClF3N2O2 — CID 103146774
1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-one (PubChem CID 103146774) has the molecular formula C12H16ClF3N2O2 and a molecular weight of 312.72 g/mol. Its IUPAC name is 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-one.
| Compound Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 103146774 |
| Molecular Formula | C12H16ClF3N2O2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
| SMILES | CCn1nc(C)c(Cl)c1CC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H16ClF3N2O2/c1-3-18-10(11(13)8(2)17-18)6-9(19)4-5-20-7-12(14,15)16/h3-7H2,1-2H3 |
| InChIKey | FXUPBDMPJAGURH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|