C12H20ClF3N4O — CID 103151695
[1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine (PubChem CID 103151695) has the molecular formula C12H20ClF3N4O and a molecular weight of 328.77 g/mol. Its IUPAC name is [1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151695 |
| Molecular Formula | C12H20ClF3N4O |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
| SMILES | CCn1nc(C)c(Cl)c1CC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C12H20ClF3N4O/c1-3-20-10(11(13)8(2)19-20)6-9(18-17)4-5-21-7-12(14,15)16/h9,18H,3-7,17H2,1-2H3 |
| InChIKey | UWKVRHYTTNFVCE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|