C10H19ClN4S — CID 105213762
[1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methylsulfanylpropan-2-yl]hydrazine (PubChem CID 105213762) has the molecular formula C10H19ClN4S and a molecular weight of 262.81 g/mol. Its IUPAC name is [1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105213762 |
| Molecular Formula | C10H19ClN4S |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methylsulfanylpropan-2-yl]hydrazine |
| SMILES | CCn1nc(C)c(Cl)c1CC(CSC)NN |
| InChI | InChI=1S/C10H19ClN4S/c1-4-15-9(10(11)7(2)14-15)5-8(13-12)6-16-3/h8,13H,4-6,12H2,1-3H3 |
| InChIKey | PQUWUZVUKRYDLO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|