C12H22ClN3S — CID 105160040
1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-methyl-4-methylsulfanylbutan-2-amine (PubChem CID 105160040) has the molecular formula C12H22ClN3S and a molecular weight of 275.85 g/mol. Its IUPAC name is 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-methyl-4-methylsulfanylbutan-2-amine.
| Compound Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-methyl-4-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 105160040 |
| Molecular Formula | C12H22ClN3S |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-methyl-4-methylsulfanylbutan-2-amine |
| SMILES | CCn1nc(C)c(Cl)c1CC(CCSC)NC |
| InChI | InChI=1S/C12H22ClN3S/c1-5-16-11(12(13)9(2)15-16)8-10(14-3)6-7-17-4/h10,14H,5-8H2,1-4H3 |
| InChIKey | XRGJKCDUVMAJEE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |