C13H24ClN3O2 — CID 79495382
3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-amine (PubChem CID 79495382) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-amine.
| Compound Name | 3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-amine |
|---|---|
| PubChem CID | 79495382 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1,1-diethoxypropan-2-amine |
| SMILES | CCOC(OCC)C(N)Cc1c(Cl)c(C)nn1CC |
| InChI | InChI=1S/C13H24ClN3O2/c1-5-17-11(12(14)9(4)16-17)8-10(15)13(18-6-2)19-7-3/h10,13H,5-8,15H2,1-4H3 |
| InChIKey | DHUVTUIDJBXWID-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|