C14H26ClN3O2 — CID 79496363
3-(4-chloro-1,3-diethylpyrazol-5-yl)-1,1-diethoxypropan-2-amine (PubChem CID 79496363) has the molecular formula C14H26ClN3O2 and a molecular weight of 303.83 g/mol. Its IUPAC name is 3-(4-chloro-1,3-diethylpyrazol-5-yl)-1,1-diethoxypropan-2-amine.
| Compound Name | 3-(4-chloro-1,3-diethylpyrazol-5-yl)-1,1-diethoxypropan-2-amine |
|---|---|
| PubChem CID | 79496363 |
| Molecular Formula | C14H26ClN3O2 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3-(4-chloro-1,3-diethylpyrazol-5-yl)-1,1-diethoxypropan-2-amine |
| SMILES | CCOC(OCC)C(N)Cc1c(Cl)c(CC)nn1CC |
| InChI | InChI=1S/C14H26ClN3O2/c1-5-11-13(15)12(18(6-2)17-11)9-10(16)14(19-7-3)20-8-4/h10,14H,5-9,16H2,1-4H3 |
| InChIKey | OBISZWJDKNWATB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|