C14H22ClN5S — CID 105214340
[1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105214340) has the molecular formula C14H22ClN5S and a molecular weight of 327.89 g/mol. Its IUPAC name is [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214340 |
| Molecular Formula | C14H22ClN5S |
| Molecular Weight | 327.89 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(Cc2nc(C)cs2)NN)c1Cl |
| InChI | InChI=1S/C14H22ClN5S/c1-4-11-14(15)12(20(5-2)19-11)6-10(18-16)7-13-17-9(3)8-21-13/h8,10,18H,4-7,16H2,1-3H3 |
| InChIKey | YWROCUSIEPSIBT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.89 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|