C11H15N3OS — CID 105214200
[1-(furan-3-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105214200) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is [1-(furan-3-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(furan-3-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214200 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | [1-(furan-3-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
| SMILES | Cc1csc(CC(Cc2ccoc2)NN)n1 |
| InChI | InChI=1S/C11H15N3OS/c1-8-7-16-11(13-8)5-10(14-12)4-9-2-3-15-6-9/h2-3,6-7,10,14H,4-5,12H2,1H3 |
| InChIKey | DKBLBRRNPPKMHQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|