C14H22N4S2 — CID 105214128
[1-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105214128) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214128 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
| SMILES | Cc1csc(CC(Cc2nc(C(C)(C)C)cs2)NN)n1 |
| InChI | InChI=1S/C14H22N4S2/c1-9-7-19-12(16-9)5-10(18-15)6-13-17-11(8-20-13)14(2,3)4/h7-8,10,18H,5-6,15H2,1-4H3 |
| InChIKey | GKRCHQRFZRXLJV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|