C16H23N3S — CID 105195130
[1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylpropan-2-yl]hydrazine (PubChem CID 105195130) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylpropan-2-yl]hydrazine.
| Compound Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105195130 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylpropan-2-yl]hydrazine |
| SMILES | CC(C)(C)c1csc(CC(Cc2ccccc2)NN)n1 |
| InChI | InChI=1S/C16H23N3S/c1-16(2,3)14-11-20-15(18-14)10-13(19-17)9-12-7-5-4-6-8-12/h4-8,11,13,19H,9-10,17H2,1-3H3 |
| InChIKey | FVHCUEOJRRKMKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|