C16H22N2OS — CID 79819973
1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-amine (PubChem CID 79819973) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-amine.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-amine |
|---|---|
| PubChem CID | 79819973 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-amine |
| SMILES | CC(C)(C)c1csc(CC(N)COc2ccccc2)n1 |
| InChI | InChI=1S/C16H22N2OS/c1-16(2,3)14-11-20-15(18-14)9-12(17)10-19-13-7-5-4-6-8-13/h4-8,11-12H,9-10,17H2,1-3H3 |
| InChIKey | UZGBUWXWDCCRGA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |