C17H22ClNS — CID 104846384
4-tert-butyl-2-(3-chloro-2-methyl-3-phenylpropyl)-1,3-thiazole (PubChem CID 104846384) has the molecular formula C17H22ClNS and a molecular weight of 307.89 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-chloro-2-methyl-3-phenylpropyl)-1,3-thiazole.
| Compound Name | 4-tert-butyl-2-(3-chloro-2-methyl-3-phenylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 104846384 |
| Molecular Formula | C17H22ClNS |
| Molecular Weight | 307.89 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-tert-butyl-2-(3-chloro-2-methyl-3-phenylpropyl)-1,3-thiazole |
| SMILES | CC(Cc1nc(C(C)(C)C)cs1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C17H22ClNS/c1-12(16(18)13-8-6-5-7-9-13)10-15-19-14(11-20-15)17(2,3)4/h5-9,11-12,16H,10H2,1-4H3 |
| InChIKey | ZZSOLLPGYKCNTO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|