C11H15NO4S — CID 116868102
2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]propanedioic acid (PubChem CID 116868102) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]propanedioic acid.
| Compound Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 116868102 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]propanedioic acid |
| SMILES | CC(C)(C)c1csc(CC(C(=O)O)C(=O)O)n1 |
| InChI | InChI=1S/C11H15NO4S/c1-11(2,3)7-5-17-8(12-7)4-6(9(13)14)10(15)16/h5-6H,4H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | UIPDBVGPXOFDAM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|