C10H15NO3S — CID 79819859
3-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxypropanoic acid (PubChem CID 79819859) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxypropanoic acid.
| Compound Name | 3-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 79819859 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxypropanoic acid |
| SMILES | CC(C)(C)c1csc(CC(O)C(=O)O)n1 |
| InChI | InChI=1S/C10H15NO3S/c1-10(2,3)7-5-15-8(11-7)4-6(12)9(13)14/h5-6,12H,4H2,1-3H3,(H,13,14) |
| InChIKey | DLNZBPLHZNTTKH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |