C12H19NO2S — CID 79817832
2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanoic acid (PubChem CID 79817832) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanoic acid.
| Compound Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 79817832 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]butanoic acid |
| SMILES | CCC(Cc1nc(C(C)(C)C)cs1)C(=O)O |
| InChI | InChI=1S/C12H19NO2S/c1-5-8(11(14)15)6-10-13-9(7-16-10)12(2,3)4/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | AORMNSXGJDCVFZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |