C12H21NO2S — CID 103454424
1-(4-tert-butyl-1,3-thiazol-2-yl)pentane-2,3-diol (PubChem CID 103454424) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)pentane-2,3-diol.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 103454424 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)pentane-2,3-diol |
| SMILES | CCC(O)C(O)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C12H21NO2S/c1-5-8(14)9(15)6-11-13-10(7-16-11)12(2,3)4/h7-9,14-15H,5-6H2,1-4H3 |
| InChIKey | BDAROHXCKBHHCW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |