C14H25NO2S — CID 105115643
1-(4-tert-butyl-1,3-thiazol-2-yl)-4-propoxybutan-2-ol (PubChem CID 105115643) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-propoxybutan-2-ol.
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-propoxybutan-2-ol |
|---|---|
| PubChem CID | 105115643 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-4-propoxybutan-2-ol |
| SMILES | CCCOCCC(O)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C14H25NO2S/c1-5-7-17-8-6-11(16)9-13-15-12(10-18-13)14(2,3)4/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | KCVPCFQYVXJZEJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|