C11H21N3S2 — CID 105213765
[1-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfanylpropan-2-yl]hydrazine (PubChem CID 105213765) has the molecular formula C11H21N3S2 and a molecular weight of 259.44 g/mol. Its IUPAC name is [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105213765 |
| Molecular Formula | C11H21N3S2 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [1-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfanylpropan-2-yl]hydrazine |
| SMILES | CSCC(Cc1nc(C(C)(C)C)cs1)NN |
| InChI | InChI=1S/C11H21N3S2/c1-11(2,3)9-7-16-10(13-9)5-8(14-12)6-15-4/h7-8,14H,5-6,12H2,1-4H3 |
| InChIKey | DNRDPYOQECDMRW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|