C15H21BrN4S — CID 105263391
4-bromo-2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-hydrazinylethyl]aniline (PubChem CID 105263391) has the molecular formula C15H21BrN4S and a molecular weight of 369.33 g/mol. Its IUPAC name is 4-bromo-2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-hydrazinylethyl]aniline.
| Compound Name | 4-bromo-2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-hydrazinylethyl]aniline |
|---|---|
| PubChem CID | 105263391 |
| Molecular Formula | C15H21BrN4S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 4-bromo-2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-hydrazinylethyl]aniline |
| SMILES | CC(C)(C)c1csc(CC(NN)c2cc(Br)ccc2N)n1 |
| InChI | InChI=1S/C15H21BrN4S/c1-15(2,3)13-8-21-14(19-13)7-12(20-18)10-6-9(16)4-5-11(10)17/h4-6,8,12,20H,7,17-18H2,1-3H3 |
| InChIKey | HEBRLTZPPPTBID-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|