C15H19Br2N3S — CID 107979295
[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine (PubChem CID 107979295) has the molecular formula C15H19Br2N3S and a molecular weight of 433.21 g/mol. Its IUPAC name is [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine.
| Compound Name | [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107979295 |
| Molecular Formula | C15H19Br2N3S |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine |
| SMILES | CC(C)(C)c1csc(CC(NN)c2cc(Br)cc(Br)c2)n1 |
| InChI | InChI=1S/C15H19Br2N3S/c1-15(2,3)13-8-21-14(19-13)7-12(20-18)9-4-10(16)6-11(17)5-9/h4-6,8,12,20H,7,18H2,1-3H3 |
| InChIKey | MUMMDKVGKNHYLV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|