C7H10ClF2N3S — CID 105265468
[1-chloro-1,1-difluoro-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105265468) has the molecular formula C7H10ClF2N3S and a molecular weight of 241.69 g/mol. Its IUPAC name is [1-chloro-1,1-difluoro-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-chloro-1,1-difluoro-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105265468 |
| Molecular Formula | C7H10ClF2N3S |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | [1-chloro-1,1-difluoro-3-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
| SMILES | Cc1csc(CC(NN)C(F)(F)Cl)n1 |
| InChI | InChI=1S/C7H10ClF2N3S/c1-4-3-14-6(12-4)2-5(13-11)7(8,9)10/h3,5,13H,2,11H2,1H3 |
| InChIKey | IQZSVSLVQGPNRM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|