C10H13N5S — CID 105214148
[2-(4-methyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethyl]hydrazine (PubChem CID 105214148) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is [2-(4-methyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethyl]hydrazine.
| Compound Name | [2-(4-methyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105214148 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | [2-(4-methyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethyl]hydrazine |
| SMILES | Cc1csc(CC(NN)c2cncnc2)n1 |
| InChI | InChI=1S/C10H13N5S/c1-7-5-16-10(14-7)2-9(15-11)8-3-12-6-13-4-8/h3-6,9,15H,2,11H2,1H3 |
| InChIKey | WRXLDMDAXWBBCF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|