C11H17N5S2 — CID 105326691
[2-(4-methyl-1,3-thiazol-2-yl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105326691) has the molecular formula C11H17N5S2 and a molecular weight of 283.43 g/mol. Its IUPAC name is [2-(4-methyl-1,3-thiazol-2-yl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(4-methyl-1,3-thiazol-2-yl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105326691 |
| Molecular Formula | C11H17N5S2 |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [2-(4-methyl-1,3-thiazol-2-yl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]hydrazine |
| SMILES | Cc1csc(CC(NN)c2snnc2C(C)C)n1 |
| InChI | InChI=1S/C11H17N5S2/c1-6(2)10-11(18-16-15-10)8(14-12)4-9-13-7(3)5-17-9/h5-6,8,14H,4,12H2,1-3H3 |
| InChIKey | AELWEEBDADGHFD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|