C12H13F2N3S — CID 105214156
[1-(2,6-difluorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105214156) has the molecular formula C12H13F2N3S and a molecular weight of 269.32 g/mol. Its IUPAC name is [1-(2,6-difluorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(2,6-difluorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105214156 |
| Molecular Formula | C12H13F2N3S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [1-(2,6-difluorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | Cc1csc(CC(NN)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C12H13F2N3S/c1-7-6-18-11(16-7)5-10(17-15)12-8(13)3-2-4-9(12)14/h2-4,6,10,17H,5,15H2,1H3 |
| InChIKey | JWSLZOBTYITCFT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|