C12H13Cl2N3S — CID 105214246
[1-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105214246) has the molecular formula C12H13Cl2N3S and a molecular weight of 302.23 g/mol. Its IUPAC name is [1-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105214246 |
| Molecular Formula | C12H13Cl2N3S |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | [1-(2,3-dichlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | Cc1csc(CC(NN)c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H13Cl2N3S/c1-7-6-18-11(16-7)5-10(17-15)8-3-2-4-9(13)12(8)14/h2-4,6,10,17H,5,15H2,1H3 |
| InChIKey | UUHHLWOKEVHMSW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|