C10H13N3OS — CID 105331808
[2-(furan-3-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105331808) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is [2-(furan-3-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(furan-3-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105331808 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | [2-(furan-3-yl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nc(C(Cc2ccoc2)NN)cs1 |
| InChI | InChI=1S/C10H13N3OS/c1-7-12-10(6-15-7)9(13-11)4-8-2-3-14-5-8/h2-3,5-6,9,13H,4,11H2,1H3 |
| InChIKey | UGCKDGVUIZJLAA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|