C12H13ClFN3S — CID 103053824
[2-(5-chloro-2-fluorophenyl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 103053824) has the molecular formula C12H13ClFN3S and a molecular weight of 285.78 g/mol. Its IUPAC name is [2-(5-chloro-2-fluorophenyl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(5-chloro-2-fluorophenyl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103053824 |
| Molecular Formula | C12H13ClFN3S |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [2-(5-chloro-2-fluorophenyl)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | Cc1nc(C(Cc2cc(Cl)ccc2F)NN)cs1 |
| InChI | InChI=1S/C12H13ClFN3S/c1-7-16-12(6-18-7)11(17-15)5-8-4-9(13)2-3-10(8)14/h2-4,6,11,17H,5,15H2,1H3 |
| InChIKey | MTTSHKAIOHBHMO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|