C13H15ClFN3S — CID 114033950
[2-(5-chloro-2-fluorophenyl)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 114033950) has the molecular formula C13H15ClFN3S and a molecular weight of 299.80 g/mol. Its IUPAC name is [2-(5-chloro-2-fluorophenyl)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(5-chloro-2-fluorophenyl)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114033950 |
| Molecular Formula | C13H15ClFN3S |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [2-(5-chloro-2-fluorophenyl)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | Cc1nc(C)c(C(Cc2cc(Cl)ccc2F)NN)s1 |
| InChI | InChI=1S/C13H15ClFN3S/c1-7-13(19-8(2)17-7)12(18-16)6-9-5-10(14)3-4-11(9)15/h3-5,12,18H,6,16H2,1-2H3 |
| InChIKey | NPMBZQRRRUEFBX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|