C14H27ClN4 — CID 105318284
[1-(4-chloro-1,3-diethylpyrazol-5-yl)-3,3-dimethylpentan-2-yl]hydrazine (PubChem CID 105318284) has the molecular formula C14H27ClN4 and a molecular weight of 286.85 g/mol. Its IUPAC name is [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3,3-dimethylpentan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3,3-dimethylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105318284 |
| Molecular Formula | C14H27ClN4 |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3,3-dimethylpentan-2-yl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(NN)C(C)(C)CC)c1Cl |
| InChI | InChI=1S/C14H27ClN4/c1-6-10-13(15)11(19(8-3)18-10)9-12(17-16)14(4,5)7-2/h12,17H,6-9,16H2,1-5H3 |
| InChIKey | NLXIVTZXHTZTLN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|