C13H18BrClN4O — CID 106860035
[1-(2-bromofuran-3-yl)-2-(4-chloro-1,3-diethylpyrazol-5-yl)ethyl]hydrazine (PubChem CID 106860035) has the molecular formula C13H18BrClN4O and a molecular weight of 361.67 g/mol. Its IUPAC name is [1-(2-bromofuran-3-yl)-2-(4-chloro-1,3-diethylpyrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(2-bromofuran-3-yl)-2-(4-chloro-1,3-diethylpyrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106860035 |
| Molecular Formula | C13H18BrClN4O |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | [1-(2-bromofuran-3-yl)-2-(4-chloro-1,3-diethylpyrazol-5-yl)ethyl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(NN)c2ccoc2Br)c1Cl |
| InChI | InChI=1S/C13H18BrClN4O/c1-3-9-12(15)11(19(4-2)18-9)7-10(17-16)8-5-6-20-13(8)14/h5-6,10,17H,3-4,7,16H2,1-2H3 |
| InChIKey | CMLCIOJFCCHOAW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|