C16H21ClIN3 — CID 105001342
2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 105001342) has the molecular formula C16H21ClIN3 and a molecular weight of 417.72 g/mol. Its IUPAC name is 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105001342 |
| Molecular Formula | C16H21ClIN3 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CCc1nn(CC)c(CC(NC)c2ccccc2I)c1Cl |
| InChI | InChI=1S/C16H21ClIN3/c1-4-13-16(17)15(21(5-2)20-13)10-14(19-3)11-8-6-7-9-12(11)18/h6-9,14,19H,4-5,10H2,1-3H3 |
| InChIKey | JCZRTYWUIIEINO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|