C15H15ClIN — CID 61079847
2-(2-chlorophenyl)-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 61079847) has the molecular formula C15H15ClIN and a molecular weight of 371.65 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(2-chlorophenyl)-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 61079847 |
| Molecular Formula | C15H15ClIN |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccccc1Cl)c1ccccc1I |
| InChI | InChI=1S/C15H15ClIN/c1-18-15(12-7-3-5-9-14(12)17)10-11-6-2-4-8-13(11)16/h2-9,15,18H,10H2,1H3 |
| InChIKey | VCCADEAPXVBAII-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|