C16H17FIN — CID 105050991
2-(4-fluoro-2-methylphenyl)-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 105050991) has the molecular formula C16H17FIN and a molecular weight of 369.22 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105050991 |
| Molecular Formula | C16H17FIN |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)cc1C)c1ccccc1I |
| InChI | InChI=1S/C16H17FIN/c1-11-9-13(17)8-7-12(11)10-16(19-2)14-5-3-4-6-15(14)18/h3-9,16,19H,10H2,1-2H3 |
| InChIKey | HZOMIEQCTJVGCP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|