C15H14ClFIN — CID 102866450
2-(3-chloro-2-fluorophenyl)-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 102866450) has the molecular formula C15H14ClFIN and a molecular weight of 389.64 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 102866450 |
| Molecular Formula | C15H14ClFIN |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cccc(Cl)c1F)c1ccccc1I |
| InChI | InChI=1S/C15H14ClFIN/c1-19-14(11-6-2-3-8-13(11)18)9-10-5-4-7-12(16)15(10)17/h2-8,14,19H,9H2,1H3 |
| InChIKey | QNHUWOUZBXFDHM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|