C14H13Cl2IN2 — CID 107312879
[2-(2,3-dichlorophenyl)-1-(2-iodophenyl)ethyl]hydrazine (PubChem CID 107312879) has the molecular formula C14H13Cl2IN2 and a molecular weight of 407.08 g/mol. Its IUPAC name is [2-(2,3-dichlorophenyl)-1-(2-iodophenyl)ethyl]hydrazine.
| Compound Name | [2-(2,3-dichlorophenyl)-1-(2-iodophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107312879 |
| Molecular Formula | C14H13Cl2IN2 |
| Molecular Weight | 407.08 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | [2-(2,3-dichlorophenyl)-1-(2-iodophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Cl)c1Cl)c1ccccc1I |
| InChI | InChI=1S/C14H13Cl2IN2/c15-11-6-3-4-9(14(11)16)8-13(19-18)10-5-1-2-7-12(10)17/h1-7,13,19H,8,18H2 |
| InChIKey | ASTQNPZJTACEKN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.08 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|