C16H21ClIN3 — CID 104998497
2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(2-iodophenyl)ethanamine (PubChem CID 104998497) has the molecular formula C16H21ClIN3 and a molecular weight of 417.72 g/mol. Its IUPAC name is 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(2-iodophenyl)ethanamine.
| Compound Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(2-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 104998497 |
| Molecular Formula | C16H21ClIN3 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(2-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1c(Cl)c(CC)nn1C)c1ccccc1I |
| InChI | InChI=1S/C16H21ClIN3/c1-4-13-16(17)15(21(3)20-13)10-14(19-5-2)11-8-6-7-9-12(11)18/h6-9,14,19H,4-5,10H2,1-3H3 |
| InChIKey | AXBAOLLYPYGXJU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|