C15H20Cl2N4 — CID 103444619
2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(3-chloro-2-pyridinyl)-N-ethylethanamine (PubChem CID 103444619) has the molecular formula C15H20Cl2N4 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(3-chloro-2-pyridinyl)-N-ethylethanamine.
| Compound Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(3-chloro-2-pyridinyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 103444619 |
| Molecular Formula | C15H20Cl2N4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(3-chloro-2-pyridinyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1c(Cl)c(CC)nn1C)c1ncccc1Cl |
| InChI | InChI=1S/C15H20Cl2N4/c1-4-11-14(17)13(21(3)20-11)9-12(18-5-2)15-10(16)7-6-8-19-15/h6-8,12,18H,4-5,9H2,1-3H3 |
| InChIKey | VXLHLKKFJZENJV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |