C12H19ClN2 — CID 103444452
1-(3-chloro-2-pyridinyl)-N-ethylpentan-1-amine (PubChem CID 103444452) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-ethylpentan-1-amine.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-ethylpentan-1-amine |
|---|---|
| PubChem CID | 103444452 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-ethylpentan-1-amine |
| SMILES | CCCCC(NCC)c1ncccc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-3-5-8-11(14-4-2)12-10(13)7-6-9-15-12/h6-7,9,11,14H,3-5,8H2,1-2H3 |
| InChIKey | XETMMXSBDIULTJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |