C14H17ClIN3 — CID 104996562
2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine (PubChem CID 104996562) has the molecular formula C14H17ClIN3 and a molecular weight of 389.67 g/mol. Its IUPAC name is 2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 104996562 |
| Molecular Formula | C14H17ClIN3 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(2-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1c(Cl)c(C)nn1C)c1ccccc1I |
| InChI | InChI=1S/C14H17ClIN3/c1-9-14(15)13(19(3)18-9)8-12(17-2)10-6-4-5-7-11(10)16/h4-7,12,17H,8H2,1-3H3 |
| InChIKey | LFEFDCGBWCRFQG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|