C12H15IN4 — CID 104997588
1-(2-iodophenyl)-N-methyl-2-(2-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 104997588) has the molecular formula C12H15IN4 and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-(2-iodophenyl)-N-methyl-2-(2-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | 1-(2-iodophenyl)-N-methyl-2-(2-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104997588 |
| Molecular Formula | C12H15IN4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(2-iodophenyl)-N-methyl-2-(2-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | CNC(Cc1ncnn1C)c1ccccc1I |
| InChI | InChI=1S/C12H15IN4/c1-14-11(7-12-15-8-16-17(12)2)9-5-3-4-6-10(9)13/h3-6,8,11,14H,7H2,1-2H3 |
| InChIKey | SONIKKUCVPZZQS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|