C14H19IN4 — CID 105002993
1-(2-iodophenyl)-N-methyl-2-(2-propyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 105002993) has the molecular formula C14H19IN4 and a molecular weight of 370.24 g/mol. Its IUPAC name is 1-(2-iodophenyl)-N-methyl-2-(2-propyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | 1-(2-iodophenyl)-N-methyl-2-(2-propyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 105002993 |
| Molecular Formula | C14H19IN4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-(2-iodophenyl)-N-methyl-2-(2-propyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | CCCn1ncnc1CC(NC)c1ccccc1I |
| InChI | InChI=1S/C14H19IN4/c1-3-8-19-14(17-10-18-19)9-13(16-2)11-6-4-5-7-12(11)15/h4-7,10,13,16H,3,8-9H2,1-2H3 |
| InChIKey | FMKBDUAMINAODA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|