C15H21BrClN3O — CID 106857947
N-[1-(2-bromofuran-3-yl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethyl]propan-1-amine (PubChem CID 106857947) has the molecular formula C15H21BrClN3O and a molecular weight of 374.71 g/mol. Its IUPAC name is N-[1-(2-bromofuran-3-yl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-bromofuran-3-yl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106857947 |
| Molecular Formula | C15H21BrClN3O |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-[1-(2-bromofuran-3-yl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(Cl)c(CC)nn1C)c1ccoc1Br |
| InChI | InChI=1S/C15H21BrClN3O/c1-4-7-18-12(10-6-8-21-15(10)16)9-13-14(17)11(5-2)19-20(13)3/h6,8,12,18H,4-5,7,9H2,1-3H3 |
| InChIKey | OKOBGXDJGBOVMC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |